C16H9BrClNO3 — CID 142659283
3-amino-4-[2-(3-bromophenoxy)-4-chlorophenyl]cyclobut-3-ene-1,2-dione (PubChem CID 142659283) has the molecular formula C16H9BrClNO3 and a molecular weight of 378.61 g/mol. Its IUPAC name is 3-amino-4-[2-(3-bromophenoxy)-4-chlorophenyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[2-(3-bromophenoxy)-4-chlorophenyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142659283 |
| Molecular Formula | C16H9BrClNO3 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 3-amino-4-[2-(3-bromophenoxy)-4-chlorophenyl]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(-c2ccc(Cl)cc2Oc2cccc(Br)c2)c(=O)c1=O |
| InChI | InChI=1S/C16H9BrClNO3/c17-8-2-1-3-10(6-8)22-12-7-9(18)4-5-11(12)13-14(19)16(21)15(13)20/h1-7H,19H2 |
| InChIKey | XRTFBNQALOUQEL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|