C15H9ClN2O3 — CID 142659371
3-amino-4-(4-chloro-2-pyridin-3-yloxyphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 142659371) has the molecular formula C15H9ClN2O3 and a molecular weight of 300.70 g/mol. Its IUPAC name is 3-amino-4-(4-chloro-2-pyridin-3-yloxyphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-(4-chloro-2-pyridin-3-yloxyphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142659371 |
| Molecular Formula | C15H9ClN2O3 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-amino-4-(4-chloro-2-pyridin-3-yloxyphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(-c2ccc(Cl)cc2Oc2cccnc2)c(=O)c1=O |
| InChI | InChI=1S/C15H9ClN2O3/c16-8-3-4-10(12-13(17)15(20)14(12)19)11(6-8)21-9-2-1-5-18-7-9/h1-7H,17H2 |
| InChIKey | GSPVYDNIGNVQMO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|