About (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate
(2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate (PubChem CID 22085830) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate.
Molecular Properties
| Compound Name | (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate |
| PubChem CID | 22085830 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate |
| SMILES | CCC1(OC(=O)C2CCCO2)CC2CCC1C2 |
| InChI | InChI=1S/C14H22O3/c1-2-14(9-10-5-6-11(14)8-10)17-13(15)12-4-3-7-16-12/h10-12H,2-9H2,1H3 |
| InChIKey | PXOYIEDTZBDSJG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate?
The IUPAC name of (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate (CID 22085830) is (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate.
What is the SMILES notation for (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate?
The canonical SMILES for (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate is CCC1(OC(=O)C2CCCO2)CC2CCC1C2.
What is the InChIKey of (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate?
The InChIKey is PXOYIEDTZBDSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-2-14(9-10-5-6-11(14)8-10)17-13(15)12-4-3-7-16-12/h10-12H,2-9H2,1H3.
What are the key properties of (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate?
(2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate has a molecular weight of 238.33 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-2-bicyclo[2.2.1]heptanyl) oxolane-2-carboxylate is sourced from PubChem (CID 22085830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).