About [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate
[2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate (PubChem CID 157379582) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate |
| PubChem CID | 157379582 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate |
| SMILES | COC(=O)C1CCCO1.OCC1(CO)CCCO1 |
| InChI | InChI=1S/C6H10O3.C6H12O3/c1-8-6(7)5-3-2-4-9-5;7-4-6(5-8)2-1-3-9-6/h5H,2-4H2,1H3;7-8H,1-5H2 |
| InChIKey | BKSISSVUSHMDKB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate?
The IUPAC name of [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate (CID 157379582) is [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate.
What is the SMILES notation for [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate?
The canonical SMILES for [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate is COC(=O)C1CCCO1.OCC1(CO)CCCO1.
What is the InChIKey of [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate?
The InChIKey is BKSISSVUSHMDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H12O3/c1-8-6(7)5-3-2-4-9-5;7-4-6(5-8)2-1-3-9-6/h5H,2-4H2,1H3;7-8H,1-5H2.
What are the key properties of [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate?
[2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate has a molecular weight of 262.30 g/mol, XLogP of -0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)oxolan-2-yl]methanol;methyl oxolane-2-carboxylate is sourced from PubChem (CID 157379582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).