C6H11NS — CID 22091758
3-propan-2-yl-2H-1,3-thiazole (PubChem CID 22091758) has the molecular formula C6H11NS and a molecular weight of 129.23 g/mol. Its IUPAC name is 3-propan-2-yl-2H-1,3-thiazole.
| Compound Name | 3-propan-2-yl-2H-1,3-thiazole |
|---|---|
| PubChem CID | 22091758 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 3-propan-2-yl-2H-1,3-thiazole |
| SMILES | CC(C)N1C=CSC1 |
| InChI | InChI=1S/C6H11NS/c1-6(2)7-3-4-8-5-7/h3-4,6H,5H2,1-2H3 |
| InChIKey | STPAPFCVPAZIGB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |