C14H11NO3S — CID 22092257
4-(pyridin-2-ylmethoxy)-1-benzothiophene 1,1-dioxide (PubChem CID 22092257) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 4-(pyridin-2-ylmethoxy)-1-benzothiophene 1,1-dioxide.
| Compound Name | 4-(pyridin-2-ylmethoxy)-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 22092257 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-(pyridin-2-ylmethoxy)-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=Cc2c(OCc3ccccn3)cccc21 |
| InChI | InChI=1S/C14H11NO3S/c16-19(17)9-7-12-13(5-3-6-14(12)19)18-10-11-4-1-2-8-15-11/h1-9H,10H2 |
| InChIKey | RCDWKWJXVUQEFQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |