C27H31N3O6S — CID 22092933
3-[[5-[3-(butylcarbamoylamino)phenyl]-2-methoxyphenyl]sulfonylamino]-3-phenylpropanoic acid (PubChem CID 22092933) has the molecular formula C27H31N3O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is 3-[[5-[3-(butylcarbamoylamino)phenyl]-2-methoxyphenyl]sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | 3-[[5-[3-(butylcarbamoylamino)phenyl]-2-methoxyphenyl]sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22092933 |
| Molecular Formula | C27H31N3O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 3-[[5-[3-(butylcarbamoylamino)phenyl]-2-methoxyphenyl]sulfonylamino]-3-phenylpropanoic acid |
| SMILES | CCCCNC(=O)Nc1cccc(-c2ccc(OC)c(S(=O)(=O)NC(CC(=O)O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H31N3O6S/c1-3-4-15-28-27(33)29-22-12-8-11-20(16-22)21-13-14-24(36-2)25(17-21)37(34,35)30-23(18-26(31)32)19-9-6-5-7-10-19/h5-14,16-17,23,30H,3-4,15,18H2,1-2H3,(H,31,32)(H2,28,29,33) |
| InChIKey | JKHVGCSTOWQERG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|