C27H31N3O5S — CID 149131958
3-[[5-[4-(butylcarbamoylamino)phenyl]-2-methoxyphenyl]sulfinylamino]-3-phenylpropanoic acid (PubChem CID 149131958) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is 3-[[5-[4-(butylcarbamoylamino)phenyl]-2-methoxyphenyl]sulfinylamino]-3-phenylpropanoic acid.
| Compound Name | 3-[[5-[4-(butylcarbamoylamino)phenyl]-2-methoxyphenyl]sulfinylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 149131958 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 3-[[5-[4-(butylcarbamoylamino)phenyl]-2-methoxyphenyl]sulfinylamino]-3-phenylpropanoic acid |
| SMILES | CCCCNC(=O)Nc1ccc(-c2ccc(OC)c(S(=O)NC(CC(=O)O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H31N3O5S/c1-3-4-16-28-27(33)29-22-13-10-19(11-14-22)21-12-15-24(35-2)25(17-21)36(34)30-23(18-26(31)32)20-8-6-5-7-9-20/h5-15,17,23,30H,3-4,16,18H2,1-2H3,(H,31,32)(H2,28,29,33) |
| InChIKey | RCQZCHNLUWKWDU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|