C16H28N2O3 — CID 22094152
2,2,7,7,9,9-hexamethyl-3-(oxiran-2-ylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-4-one (PubChem CID 22094152) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2,2,7,7,9,9-hexamethyl-3-(oxiran-2-ylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-4-one.
| Compound Name | 2,2,7,7,9,9-hexamethyl-3-(oxiran-2-ylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 22094152 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2,2,7,7,9,9-hexamethyl-3-(oxiran-2-ylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
| SMILES | CC1(C)CC2(CC(C)(C)N1)OC(C)(C)N(CC1CO1)C2=O |
| InChI | InChI=1S/C16H28N2O3/c1-13(2)9-16(10-14(3,4)17-13)12(19)18(7-11-8-20-11)15(5,6)21-16/h11,17H,7-10H2,1-6H3 |
| InChIKey | UPFYYSSYSLIKBD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|