C10H15O5PS — CID 22095295
1-phenylethylsulfanylmethoxymethyl dihydrogen phosphate (PubChem CID 22095295) has the molecular formula C10H15O5PS and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-phenylethylsulfanylmethoxymethyl dihydrogen phosphate.
| Compound Name | 1-phenylethylsulfanylmethoxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 22095295 |
| Molecular Formula | C10H15O5PS |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1-phenylethylsulfanylmethoxymethyl dihydrogen phosphate |
| SMILES | CC(SCOCOP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C10H15O5PS/c1-9(10-5-3-2-4-6-10)17-8-14-7-15-16(11,12)13/h2-6,9H,7-8H2,1H3,(H2,11,12,13) |
| InChIKey | FLRWTGGFWIVTOP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|