C19H21F3N2OS — CID 2209557
1-(5-tert-butyl-2-methoxyphenyl)-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 2209557) has the molecular formula C19H21F3N2OS and a molecular weight of 382.45 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methoxyphenyl)-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(5-tert-butyl-2-methoxyphenyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2209557 |
| Molecular Formula | C19H21F3N2OS |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-(5-tert-butyl-2-methoxyphenyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=S)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H21F3N2OS/c1-18(2,3)12-9-10-16(25-4)15(11-12)24-17(26)23-14-8-6-5-7-13(14)19(20,21)22/h5-11H,1-4H3,(H2,23,24,26) |
| InChIKey | XVNBYCYVPMNNQL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|