C34H37NO5 — CID 22096467
3-[1-benzyl-4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-methylpyrrolidine-3-carbonyl]-4-phenyloxolan-2-one (PubChem CID 22096467) has the molecular formula C34H37NO5 and a molecular weight of 539.67 g/mol. Its IUPAC name is 3-[1-benzyl-4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-methylpyrrolidine-3-carbonyl]-4-phenyloxolan-2-one.
| Compound Name | 3-[1-benzyl-4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-methylpyrrolidine-3-carbonyl]-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 22096467 |
| Molecular Formula | C34H37NO5 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 3-[1-benzyl-4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-methylpyrrolidine-3-carbonyl]-4-phenyloxolan-2-one |
| SMILES | COc1ccc(C2CN(Cc3ccccc3)CC2(C)C(=O)C2C(=O)OCC2c2ccccc2)cc1OCC1CC1 |
| InChI | InChI=1S/C34H37NO5/c1-34(32(36)31-27(21-40-33(31)37)25-11-7-4-8-12-25)22-35(18-23-9-5-3-6-10-23)19-28(34)26-15-16-29(38-2)30(17-26)39-20-24-13-14-24/h3-12,15-17,24,27-28,31H,13-14,18-22H2,1-2H3 |
| InChIKey | LXZHKAATABPYIZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|