C27H29NO3 — CID 59902301
(4S)-1-benzyl-4-(4-methoxy-3-phenylmethoxyphenyl)-3-methylpyrrolidine-3-carbaldehyde (PubChem CID 59902301) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is (4S)-1-benzyl-4-(4-methoxy-3-phenylmethoxyphenyl)-3-methylpyrrolidine-3-carbaldehyde.
| Compound Name | (4S)-1-benzyl-4-(4-methoxy-3-phenylmethoxyphenyl)-3-methylpyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 59902301 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (4S)-1-benzyl-4-(4-methoxy-3-phenylmethoxyphenyl)-3-methylpyrrolidine-3-carbaldehyde |
| SMILES | COc1ccc([C@@H]2CN(Cc3ccccc3)CC2(C)C=O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H29NO3/c1-27(20-29)19-28(16-21-9-5-3-6-10-21)17-24(27)23-13-14-25(30-2)26(15-23)31-18-22-11-7-4-8-12-22/h3-15,20,24H,16-19H2,1-2H3/t24-,27?/m0/s1 |
| InChIKey | ZJGQIDXUHMXYKA-BXXZMZEQSA-N |
| XLogP | 5.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|