About acetic acid;1-nitronaphthalen-2-amine
acetic acid;1-nitronaphthalen-2-amine (PubChem CID 22097140) has the molecular formula C12H12N2O4
and a molecular weight of 248.24 g/mol. Its IUPAC name is acetic acid;1-nitronaphthalen-2-amine.
Molecular Properties
| Compound Name | acetic acid;1-nitronaphthalen-2-amine |
| PubChem CID | 22097140 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | acetic acid;1-nitronaphthalen-2-amine |
| SMILES | CC(=O)O.Nc1ccc2ccccc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N2O2.C2H4O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12(13)14;1-2(3)4/h1-6H,11H2;1H3,(H,3,4) |
| InChIKey | LWIXPKNCIOZIPI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-nitronaphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-nitronaphthalen-2-amine?
The IUPAC name of acetic acid;1-nitronaphthalen-2-amine (CID 22097140) is acetic acid;1-nitronaphthalen-2-amine.
What is the SMILES notation for acetic acid;1-nitronaphthalen-2-amine?
The canonical SMILES for acetic acid;1-nitronaphthalen-2-amine is CC(=O)O.Nc1ccc2ccccc2c1[N+](=O)[O-].
What is the InChIKey of acetic acid;1-nitronaphthalen-2-amine?
The InChIKey is LWIXPKNCIOZIPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.C2H4O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12(13)14;1-2(3)4/h1-6H,11H2;1H3,(H,3,4).
What are the key properties of acetic acid;1-nitronaphthalen-2-amine?
acetic acid;1-nitronaphthalen-2-amine has a molecular weight of 248.24 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-nitronaphthalen-2-amine is sourced from PubChem (CID 22097140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).