C18H31N3O2Si — CID 22097380
ethyl 4-ethyl-6-[(4-trimethylsilylcyclohexyl)amino]pyrimidine-5-carboxylate (PubChem CID 22097380) has the molecular formula C18H31N3O2Si and a molecular weight of 349.55 g/mol. Its IUPAC name is ethyl 4-ethyl-6-[(4-trimethylsilylcyclohexyl)amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-ethyl-6-[(4-trimethylsilylcyclohexyl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22097380 |
| Molecular Formula | C18H31N3O2Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | ethyl 4-ethyl-6-[(4-trimethylsilylcyclohexyl)amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(CC)ncnc1NC1CCC([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C18H31N3O2Si/c1-6-15-16(18(22)23-7-2)17(20-12-19-15)21-13-8-10-14(11-9-13)24(3,4)5/h12-14H,6-11H2,1-5H3,(H,19,20,21) |
| InChIKey | AUEDLTBBFVQONX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|