C10H11NO2S — CID 22101824
5-[furan-2-yl(methoxy)methyl]-4-methyl-1,3-thiazole (PubChem CID 22101824) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 5-[furan-2-yl(methoxy)methyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[furan-2-yl(methoxy)methyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 22101824 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5-[furan-2-yl(methoxy)methyl]-4-methyl-1,3-thiazole |
| SMILES | COC(c1ccco1)c1scnc1C |
| InChI | InChI=1S/C10H11NO2S/c1-7-10(14-6-11-7)9(12-2)8-4-3-5-13-8/h3-6,9H,1-2H3 |
| InChIKey | HIFGXVAXJVQMRP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |