C15H16N2O4 — CID 22104464
2-[2-(hydroxymethyl)pyrrolidine-1-carbonyl]indole-1-carboxylic acid (PubChem CID 22104464) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)pyrrolidine-1-carbonyl]indole-1-carboxylic acid.
| Compound Name | 2-[2-(hydroxymethyl)pyrrolidine-1-carbonyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 22104464 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[2-(hydroxymethyl)pyrrolidine-1-carbonyl]indole-1-carboxylic acid |
| SMILES | O=C(c1cc2ccccc2n1C(=O)O)N1CCCC1CO |
| InChI | InChI=1S/C15H16N2O4/c18-9-11-5-3-7-16(11)14(19)13-8-10-4-1-2-6-12(10)17(13)15(20)21/h1-2,4,6,8,11,18H,3,5,7,9H2,(H,20,21) |
| InChIKey | IIEKYPFTXCPDJF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |