C37H33Cl2N3O3 — CID 22106653
O-[4,4-bis[3-chloro-4-(quinolin-2-ylmethoxy)phenyl]pentyl]hydroxylamine (PubChem CID 22106653) has the molecular formula C37H33Cl2N3O3 and a molecular weight of 638.60 g/mol. Its IUPAC name is O-[4,4-bis[3-chloro-4-(quinolin-2-ylmethoxy)phenyl]pentyl]hydroxylamine.
| Compound Name | O-[4,4-bis[3-chloro-4-(quinolin-2-ylmethoxy)phenyl]pentyl]hydroxylamine |
|---|---|
| PubChem CID | 22106653 |
| Molecular Formula | C37H33Cl2N3O3 |
| Molecular Weight | 638.60 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | O-[4,4-bis[3-chloro-4-(quinolin-2-ylmethoxy)phenyl]pentyl]hydroxylamine |
| SMILES | CC(CCCON)(c1ccc(OCc2ccc3ccccc3n2)c(Cl)c1)c1ccc(OCc2ccc3ccccc3n2)c(Cl)c1 |
| InChI | InChI=1S/C37H33Cl2N3O3/c1-37(19-6-20-45-40,27-13-17-35(31(38)21-27)43-23-29-15-11-25-7-2-4-9-33(25)41-29)28-14-18-36(32(39)22-28)44-24-30-16-12-26-8-3-5-10-34(26)42-30/h2-5,7-18,21-22H,6,19-20,23-24,40H2,1H3 |
| InChIKey | LIBLDPWGWRCWKI-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.60 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|