C27H25N3O5 — CID 22107875
5-(1-benzofuran-2-yl)-3-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 22107875) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-3-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1-benzofuran-2-yl)-3-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22107875 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-3-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)CN3C(=O)NC(C)(c4cc5ccccc5o4)C3=O)c2C)cc1 |
| InChI | InChI=1S/C27H25N3O5/c1-16-13-21(17(2)30(16)19-9-11-20(34-4)12-10-19)22(31)15-29-25(32)27(3,28-26(29)33)24-14-18-7-5-6-8-23(18)35-24/h5-14H,15H2,1-4H3,(H,28,33) |
| InChIKey | DWIOSEZBDXEOJY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|