C15H18N2O5 — CID 22108050
5-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 22108050) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 5-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 22108050 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CN2C(=O)NC3(CCCCC3)C2=O)cc1C(=O)O |
| InChI | InChI=1S/C15H18N2O5/c1-9-11(12(18)19)7-10(22-9)8-17-13(20)15(16-14(17)21)5-3-2-4-6-15/h7H,2-6,8H2,1H3,(H,16,21)(H,18,19) |
| InChIKey | RHZPPHOYRCVVEB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|