C18H18N2O5 — CID 40748417
methyl 2-methyl-5-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate (PubChem CID 40748417) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl 2-methyl-5-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 40748417 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 2-methyl-5-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CN2C(=O)N[C@](C)(c3ccccc3)C2=O)oc1C |
| InChI | InChI=1S/C18H18N2O5/c1-11-14(15(21)24-3)9-13(25-11)10-20-16(22)18(2,19-17(20)23)12-7-5-4-6-8-12/h4-9H,10H2,1-3H3,(H,19,23)/t18-/m1/s1 |
| InChIKey | KWTGZNRHIBPBCK-GOSISDBHSA-N |
| XLogP | 2.34 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|