C18H18N2O5 — CID 17468500
methyl 5-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]furan-2-carboxylate (PubChem CID 17468500) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl 5-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 17468500 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 5-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]furan-2-carboxylate |
| SMILES | CCC1(c2ccccc2)NC(=O)N(Cc2ccc(C(=O)OC)o2)C1=O |
| InChI | InChI=1S/C18H18N2O5/c1-3-18(12-7-5-4-6-8-12)16(22)20(17(23)19-18)11-13-9-10-14(25-13)15(21)24-2/h4-10H,3,11H2,1-2H3,(H,19,23) |
| InChIKey | AHOZIIOXVMCGCZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|