C16H22N2O5 — CID 35845670
methyl 5-[(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)methyl]furan-2-carboxylate (PubChem CID 35845670) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 5-[(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 35845670 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl 5-[(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)methyl]furan-2-carboxylate |
| SMILES | CCCC1(CCC)NC(=O)N(Cc2ccc(C(=O)OC)o2)C1=O |
| InChI | InChI=1S/C16H22N2O5/c1-4-8-16(9-5-2)14(20)18(15(21)17-16)10-11-6-7-12(23-11)13(19)22-3/h6-7H,4-5,8-10H2,1-3H3,(H,17,21) |
| InChIKey | LGLYSOSQDXSPGM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|