C36H36N8 — CID 22114999
(E)-N-benzyl-N,N',N'-tris[(1-methylbenzimidazol-2-yl)methyl]ethene-1,2-diamine (PubChem CID 22114999) has the molecular formula C36H36N8 and a molecular weight of 580.74 g/mol. Its IUPAC name is (E)-N-benzyl-N,N',N'-tris[(1-methylbenzimidazol-2-yl)methyl]ethene-1,2-diamine.
| Compound Name | (E)-N-benzyl-N,N',N'-tris[(1-methylbenzimidazol-2-yl)methyl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 22114999 |
| Molecular Formula | C36H36N8 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | (E)-N-benzyl-N,N',N'-tris[(1-methylbenzimidazol-2-yl)methyl]ethene-1,2-diamine |
| SMILES | Cn1c(CN(/C=C/N(Cc2nc3ccccc3n2C)Cc2nc3ccccc3n2C)Cc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C36H36N8/c1-40-31-18-10-7-15-28(31)37-34(40)24-43(23-27-13-5-4-6-14-27)21-22-44(25-35-38-29-16-8-11-19-32(29)41(35)2)26-36-39-30-17-9-12-20-33(30)42(36)3/h4-22H,23-26H2,1-3H3/b22-21+ |
| InChIKey | BOKCCSKRGHEZSU-QURGRASLSA-N |
| XLogP | 6.52 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |