C14H13BrFNO2S — CID 22115874
ethyl 5-(2-bromoethyl)-4-(4-fluorophenyl)-1,3-thiazole-2-carboxylate (PubChem CID 22115874) has the molecular formula C14H13BrFNO2S and a molecular weight of 358.23 g/mol. Its IUPAC name is ethyl 5-(2-bromoethyl)-4-(4-fluorophenyl)-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 5-(2-bromoethyl)-4-(4-fluorophenyl)-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 22115874 |
| Molecular Formula | C14H13BrFNO2S |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | ethyl 5-(2-bromoethyl)-4-(4-fluorophenyl)-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(F)cc2)c(CCBr)s1 |
| InChI | InChI=1S/C14H13BrFNO2S/c1-2-19-14(18)13-17-12(11(20-13)7-8-15)9-3-5-10(16)6-4-9/h3-6H,2,7-8H2,1H3 |
| InChIKey | ZEDJAOOLHZESPQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|