C19H23NO5 — CID 22118254
ethyl 4-methyl-4-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)-3-oxopentanoate (PubChem CID 22118254) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is ethyl 4-methyl-4-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)-3-oxopentanoate.
| Compound Name | ethyl 4-methyl-4-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)-3-oxopentanoate |
|---|---|
| PubChem CID | 22118254 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | ethyl 4-methyl-4-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)-3-oxopentanoate |
| SMILES | CCOC(=O)CC(=O)C(C)(C)N1COC(C)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H23NO5/c1-5-24-16(22)11-15(21)19(3,4)20-12-25-13(2)17(18(20)23)14-9-7-6-8-10-14/h6-10H,5,11-12H2,1-4H3 |
| InChIKey | CTYYSWOBJRDFCV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|