C25H24FNO5 — CID 54288846
methyl 2-[(2-fluorophenyl)methylidene]-4-methyl-4-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)-3-oxopentanoate (PubChem CID 54288846) has the molecular formula C25H24FNO5 and a molecular weight of 437.47 g/mol. Its IUPAC name is methyl 2-[(2-fluorophenyl)methylidene]-4-methyl-4-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)-3-oxopentanoate.
| Compound Name | methyl 2-[(2-fluorophenyl)methylidene]-4-methyl-4-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)-3-oxopentanoate |
|---|---|
| PubChem CID | 54288846 |
| Molecular Formula | C25H24FNO5 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | methyl 2-[(2-fluorophenyl)methylidene]-4-methyl-4-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)-3-oxopentanoate |
| SMILES | COC(=O)C(=Cc1ccccc1F)C(=O)C(C)(C)N1COC(C)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H24FNO5/c1-16-21(17-10-6-5-7-11-17)23(29)27(15-32-16)25(2,3)22(28)19(24(30)31-4)14-18-12-8-9-13-20(18)26/h5-14H,15H2,1-4H3 |
| InChIKey | RWBNBTZQPQMHGA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|