C18H14FNO5 — CID 58317254
4-ethyl-6-[2-(3-fluorophenyl)-2-oxoethyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317254) has the molecular formula C18H14FNO5 and a molecular weight of 343.31 g/mol. Its IUPAC name is 4-ethyl-6-[2-(3-fluorophenyl)-2-oxoethyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-ethyl-6-[2-(3-fluorophenyl)-2-oxoethyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317254 |
| Molecular Formula | C18H14FNO5 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-ethyl-6-[2-(3-fluorophenyl)-2-oxoethyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | CCc1cc(=O)oc2c1C(=O)N(CC(=O)c1cccc(F)c1)C(=O)C2 |
| InChI | InChI=1S/C18H14FNO5/c1-2-10-7-16(23)25-14-8-15(22)20(18(24)17(10)14)9-13(21)11-4-3-5-12(19)6-11/h3-7H,2,8-9H2,1H3 |
| InChIKey | VZUSZBYXODQJCG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|