C21H15NO6 — CID 2211859
[3-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-4-oxochromen-7-yl] acetate (PubChem CID 2211859) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-4-oxochromen-7-yl] acetate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-4-oxochromen-7-yl] acetate |
|---|---|
| PubChem CID | 2211859 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-4-oxochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(=O)c(N3C(=O)c4ccccc4C3=O)c(C)oc2c1C |
| InChI | InChI=1S/C21H15NO6/c1-10-16(28-12(3)23)9-8-15-18(24)17(11(2)27-19(10)15)22-20(25)13-6-4-5-7-14(13)21(22)26/h4-9H,1-3H3 |
| InChIKey | AHZGLZLLNIIYFJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|