About dimethylsulfanium;ethyl 2-bromoacetate
dimethylsulfanium;ethyl 2-bromoacetate (PubChem CID 22119103) has the molecular formula C6H14BrO2S+
and a molecular weight of 230.15 g/mol. Its IUPAC name is dimethylsulfanium;ethyl 2-bromoacetate.
Molecular Properties
| Compound Name | dimethylsulfanium;ethyl 2-bromoacetate |
| PubChem CID | 22119103 |
| Molecular Formula | C6H14BrO2S+ |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | dimethylsulfanium;ethyl 2-bromoacetate |
| SMILES | CCOC(=O)CBr.C[SH+]C |
| InChI | InChI=1S/C4H7BrO2.C2H6S/c1-2-7-4(6)3-5;1-3-2/h2-3H2,1H3;1-2H3/p+1 |
| InChIKey | NPGNHCUIKVYZLX-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylsulfanium;ethyl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsulfanium;ethyl 2-bromoacetate?
The IUPAC name of dimethylsulfanium;ethyl 2-bromoacetate (CID 22119103) is dimethylsulfanium;ethyl 2-bromoacetate.
What is the SMILES notation for dimethylsulfanium;ethyl 2-bromoacetate?
The canonical SMILES for dimethylsulfanium;ethyl 2-bromoacetate is CCOC(=O)CBr.C[SH+]C.
What is the InChIKey of dimethylsulfanium;ethyl 2-bromoacetate?
The InChIKey is NPGNHCUIKVYZLX-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H7BrO2.C2H6S/c1-2-7-4(6)3-5;1-3-2/h2-3H2,1H3;1-2H3/p+1.
What are the key properties of dimethylsulfanium;ethyl 2-bromoacetate?
dimethylsulfanium;ethyl 2-bromoacetate has a molecular weight of 230.15 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsulfanium;ethyl 2-bromoacetate is sourced from PubChem (CID 22119103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).