C9H18Cl2O4S2 — CID 22119404
1,4-bis(2-chloroethylsulfonyl)pentane (PubChem CID 22119404) has the molecular formula C9H18Cl2O4S2 and a molecular weight of 325.28 g/mol. Its IUPAC name is 1,4-bis(2-chloroethylsulfonyl)pentane.
| Compound Name | 1,4-bis(2-chloroethylsulfonyl)pentane |
|---|---|
| PubChem CID | 22119404 |
| Molecular Formula | C9H18Cl2O4S2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 1,4-bis(2-chloroethylsulfonyl)pentane |
| SMILES | CC(CCCS(=O)(=O)CCCl)S(=O)(=O)CCCl |
| InChI | InChI=1S/C9H18Cl2O4S2/c1-9(17(14,15)8-5-11)3-2-6-16(12,13)7-4-10/h9H,2-8H2,1H3 |
| InChIKey | XDCMGHVZSKCAOT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|