C7H14Cl2O5S2 — CID 98090607
(1S)-1,3-bis(2-chloroethylsulfonyl)propan-1-ol (PubChem CID 98090607) has the molecular formula C7H14Cl2O5S2 and a molecular weight of 313.22 g/mol. Its IUPAC name is (1S)-1,3-bis(2-chloroethylsulfonyl)propan-1-ol.
| Compound Name | (1S)-1,3-bis(2-chloroethylsulfonyl)propan-1-ol |
|---|---|
| PubChem CID | 98090607 |
| Molecular Formula | C7H14Cl2O5S2 |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | (1S)-1,3-bis(2-chloroethylsulfonyl)propan-1-ol |
| SMILES | O=S(=O)(CCCl)CC[C@@H](O)S(=O)(=O)CCCl |
| InChI | InChI=1S/C7H14Cl2O5S2/c8-2-5-15(11,12)4-1-7(10)16(13,14)6-3-9/h7,10H,1-6H2/t7-/m0/s1 |
| InChIKey | YPKLASYHNLGXQO-ZETCQYMHSA-N |
| XLogP | 0.00 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|