C20H26N2OS2 — CID 22120407
8-[3-(dimethylamino)propylsulfanyl]-3,3-dimethyl-5-(1,3-thiazol-2-yl)-2,4-dihydronaphthalen-1-one (PubChem CID 22120407) has the molecular formula C20H26N2OS2 and a molecular weight of 374.58 g/mol. Its IUPAC name is 8-[3-(dimethylamino)propylsulfanyl]-3,3-dimethyl-5-(1,3-thiazol-2-yl)-2,4-dihydronaphthalen-1-one.
| Compound Name | 8-[3-(dimethylamino)propylsulfanyl]-3,3-dimethyl-5-(1,3-thiazol-2-yl)-2,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 22120407 |
| Molecular Formula | C20H26N2OS2 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 8-[3-(dimethylamino)propylsulfanyl]-3,3-dimethyl-5-(1,3-thiazol-2-yl)-2,4-dihydronaphthalen-1-one |
| SMILES | CN(C)CCCSc1ccc(-c2nccs2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C20H26N2OS2/c1-20(2)12-15-14(19-21-8-11-25-19)6-7-17(18(15)16(23)13-20)24-10-5-9-22(3)4/h6-8,11H,5,9-10,12-13H2,1-4H3 |
| InChIKey | MCMHFJRZQGVTMQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|