C21H23NOS — CID 22131190
N-[2-(2-benzyl-5-ethyl-1-benzofuran-3-yl)ethyl]ethanethioamide (PubChem CID 22131190) has the molecular formula C21H23NOS and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[2-(2-benzyl-5-ethyl-1-benzofuran-3-yl)ethyl]ethanethioamide.
| Compound Name | N-[2-(2-benzyl-5-ethyl-1-benzofuran-3-yl)ethyl]ethanethioamide |
|---|---|
| PubChem CID | 22131190 |
| Molecular Formula | C21H23NOS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[2-(2-benzyl-5-ethyl-1-benzofuran-3-yl)ethyl]ethanethioamide |
| SMILES | CCc1ccc2oc(Cc3ccccc3)c(CCNC(C)=S)c2c1 |
| InChI | InChI=1S/C21H23NOS/c1-3-16-9-10-20-19(13-16)18(11-12-22-15(2)24)21(23-20)14-17-7-5-4-6-8-17/h4-10,13H,3,11-12,14H2,1-2H3,(H,22,24) |
| InChIKey | REBUTQCLIXZLFR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|