C21H17F6NO5S — CID 18360722
[3-(2-acetamidoethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]-1-benzofuran-5-yl] trifluoromethanesulfonate (PubChem CID 18360722) has the molecular formula C21H17F6NO5S and a molecular weight of 509.42 g/mol. Its IUPAC name is [3-(2-acetamidoethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]-1-benzofuran-5-yl] trifluoromethanesulfonate.
| Compound Name | [3-(2-acetamidoethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]-1-benzofuran-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18360722 |
| Molecular Formula | C21H17F6NO5S |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | [3-(2-acetamidoethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]-1-benzofuran-5-yl] trifluoromethanesulfonate |
| SMILES | CC(=O)NCCc1c(Cc2ccc(C(F)(F)F)cc2)oc2ccc(OS(=O)(=O)C(F)(F)F)cc12 |
| InChI | InChI=1S/C21H17F6NO5S/c1-12(29)28-9-8-16-17-11-15(33-34(30,31)21(25,26)27)6-7-18(17)32-19(16)10-13-2-4-14(5-3-13)20(22,23)24/h2-7,11H,8-10H2,1H3,(H,28,29) |
| InChIKey | DVFHZMMMGHPJHO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|