C29H27NO4 — CID 2213890
(1R)-1-(4-butoxyphenyl)-2-[(4-methylphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 2213890) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is (1R)-1-(4-butoxyphenyl)-2-[(4-methylphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-1-(4-butoxyphenyl)-2-[(4-methylphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 2213890 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (1R)-1-(4-butoxyphenyl)-2-[(4-methylphenyl)methyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc([C@@H]2c3c(oc4ccccc4c3=O)C(=O)N2Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H27NO4/c1-3-4-17-33-22-15-13-21(14-16-22)26-25-27(31)23-7-5-6-8-24(23)34-28(25)29(32)30(26)18-20-11-9-19(2)10-12-20/h5-16,26H,3-4,17-18H2,1-2H3/t26-/m1/s1 |
| InChIKey | IEWZHGFSYCHAOY-AREMUKBSSA-N |
| XLogP | 6.03 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|