C18H14ClF2N3O4 — CID 22139975
methyl (E)-3-[4-amino-2-[(2-chloro-4,5-difluorobenzoyl)carbamoylamino]phenyl]prop-2-enoate (PubChem CID 22139975) has the molecular formula C18H14ClF2N3O4 and a molecular weight of 409.78 g/mol. Its IUPAC name is methyl (E)-3-[4-amino-2-[(2-chloro-4,5-difluorobenzoyl)carbamoylamino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-amino-2-[(2-chloro-4,5-difluorobenzoyl)carbamoylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 22139975 |
| Molecular Formula | C18H14ClF2N3O4 |
| Molecular Weight | 409.78 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | methyl (E)-3-[4-amino-2-[(2-chloro-4,5-difluorobenzoyl)carbamoylamino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(N)cc1NC(=O)NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C18H14ClF2N3O4/c1-28-16(25)5-3-9-2-4-10(22)6-15(9)23-18(27)24-17(26)11-7-13(20)14(21)8-12(11)19/h2-8H,22H2,1H3,(H2,23,24,26,27)/b5-3+ |
| InChIKey | MKMQWOGRAIDFEO-HWKANZROSA-N |
| XLogP | 3.35 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|