About 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid
2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid (PubChem CID 22143506) has the molecular formula C17H11NO3S2
and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid |
| PubChem CID | 22143506 |
| Molecular Formula | C17H11NO3S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid |
| SMILES | Cc1sc2cc(Oc3ccnc4ccsc34)ccc2c1C(=O)O |
| InChI | InChI=1S/C17H11NO3S2/c1-9-15(17(19)20)11-3-2-10(8-14(11)23-9)21-13-4-6-18-12-5-7-22-16(12)13/h2-8H,1H3,(H,19,20) |
| InChIKey | LRTRIKKCTKORGD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid (CID 22143506) is 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid is Cc1sc2cc(Oc3ccnc4ccsc34)ccc2c1C(=O)O.
What is the InChIKey of 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid?
The InChIKey is LRTRIKKCTKORGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO3S2/c1-9-15(17(19)20)11-3-2-10(8-14(11)23-9)21-13-4-6-18-12-5-7-22-16(12)13/h2-8H,1H3,(H,19,20).
What are the key properties of 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid?
2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid has a molecular weight of 341.41 g/mol, XLogP of 5.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-thieno[3,2-b]pyridin-7-yloxy-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 22143506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).