C27H29N3O4S — CID 11431839
6-(7-methoxyquinolin-4-yl)oxy-2-methyl-N-(3-morpholin-4-ylpropyl)-1-benzothiophene-3-carboxamide (PubChem CID 11431839) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 6-(7-methoxyquinolin-4-yl)oxy-2-methyl-N-(3-morpholin-4-ylpropyl)-1-benzothiophene-3-carboxamide.
| Compound Name | 6-(7-methoxyquinolin-4-yl)oxy-2-methyl-N-(3-morpholin-4-ylpropyl)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 11431839 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 6-(7-methoxyquinolin-4-yl)oxy-2-methyl-N-(3-morpholin-4-ylpropyl)-1-benzothiophene-3-carboxamide |
| SMILES | COc1ccc2c(Oc3ccc4c(C(=O)NCCCN5CCOCC5)c(C)sc4c3)ccnc2c1 |
| InChI | InChI=1S/C27H29N3O4S/c1-18-26(27(31)29-9-3-11-30-12-14-33-15-13-30)22-7-5-20(17-25(22)35-18)34-24-8-10-28-23-16-19(32-2)4-6-21(23)24/h4-8,10,16-17H,3,9,11-15H2,1-2H3,(H,29,31) |
| InChIKey | CQTMTEIABLMKEA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|