C24H27NO5 — CID 22143757
2-[methoxycarbonyl-[2-(5-naphthalen-1-ylfuran-2-yl)ethyl]amino]-4-methylpentanoic acid (PubChem CID 22143757) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 2-[methoxycarbonyl-[2-(5-naphthalen-1-ylfuran-2-yl)ethyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[methoxycarbonyl-[2-(5-naphthalen-1-ylfuran-2-yl)ethyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22143757 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-[methoxycarbonyl-[2-(5-naphthalen-1-ylfuran-2-yl)ethyl]amino]-4-methylpentanoic acid |
| SMILES | COC(=O)N(CCc1ccc(-c2cccc3ccccc23)o1)C(CC(C)C)C(=O)O |
| InChI | InChI=1S/C24H27NO5/c1-16(2)15-21(23(26)27)25(24(28)29-3)14-13-18-11-12-22(30-18)20-10-6-8-17-7-4-5-9-19(17)20/h4-12,16,21H,13-15H2,1-3H3,(H,26,27) |
| InChIKey | QKHXEDRCOSANEP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |