C21H25NO3S — CID 22143911
4-methyl-2-[[3-(4-phenylphenyl)-2-sulfanylpropanoyl]amino]pentanoic acid (PubChem CID 22143911) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 4-methyl-2-[[3-(4-phenylphenyl)-2-sulfanylpropanoyl]amino]pentanoic acid.
| Compound Name | 4-methyl-2-[[3-(4-phenylphenyl)-2-sulfanylpropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 22143911 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-methyl-2-[[3-(4-phenylphenyl)-2-sulfanylpropanoyl]amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(S)Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H25NO3S/c1-14(2)12-18(21(24)25)22-20(23)19(26)13-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h3-11,14,18-19,26H,12-13H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | QLTJNPBRZCWAQQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|