C18H21NO4 — CID 22144227
2-[[carboxy(naphthalen-2-yl)methyl]amino]-4-methylpentanoic acid (PubChem CID 22144227) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[[carboxy(naphthalen-2-yl)methyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[carboxy(naphthalen-2-yl)methyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22144227 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-[[carboxy(naphthalen-2-yl)methyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(C(=O)O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C18H21NO4/c1-11(2)9-15(17(20)21)19-16(18(22)23)14-8-7-12-5-3-4-6-13(12)10-14/h3-8,10-11,15-16,19H,9H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | IQIJSDVGZBTXNU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |