C20H14FNO3S — CID 22148198
(E)-2-benzamido-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 22148198) has the molecular formula C20H14FNO3S and a molecular weight of 367.40 g/mol. Its IUPAC name is (E)-2-benzamido-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22148198 |
| Molecular Formula | C20H14FNO3S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (E)-2-benzamido-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(-c2ccccc2F)s1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H14FNO3S/c21-16-9-5-4-8-15(16)18-11-10-14(26-18)12-17(20(24)25)22-19(23)13-6-2-1-3-7-13/h1-12H,(H,22,23)(H,24,25)/b17-12+ |
| InChIKey | RXCJGOHYKJHOOG-SFQUDFHCSA-N |
| XLogP | 4.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|