C22H23ClFN3O2 — CID 22150162
2-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]phthalazin-1-one;hydrochloride (PubChem CID 22150162) has the molecular formula C22H23ClFN3O2 and a molecular weight of 415.90 g/mol. Its IUPAC name is 2-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]phthalazin-1-one;hydrochloride.
| Compound Name | 2-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]phthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 22150162 |
| Molecular Formula | C22H23ClFN3O2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]phthalazin-1-one;hydrochloride |
| SMILES | Cl.O=C(c1ccc(F)cc1)C1CCN(CCn2ncc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C22H22FN3O2.ClH/c23-19-7-5-16(6-8-19)21(27)17-9-11-25(12-10-17)13-14-26-22(28)20-4-2-1-3-18(20)15-24-26;/h1-8,15,17H,9-14H2;1H |
| InChIKey | UWUGCCQJWUZJSU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |