C19H20ClNO5S — CID 22152207
6-[[2-(4-chlorobenzoyl)phenyl]sulfonylamino]hexanoic acid (PubChem CID 22152207) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is 6-[[2-(4-chlorobenzoyl)phenyl]sulfonylamino]hexanoic acid.
| Compound Name | 6-[[2-(4-chlorobenzoyl)phenyl]sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 22152207 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 6-[[2-(4-chlorobenzoyl)phenyl]sulfonylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNS(=O)(=O)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO5S/c20-15-11-9-14(10-12-15)19(24)16-6-3-4-7-17(16)27(25,26)21-13-5-1-2-8-18(22)23/h3-4,6-7,9-12,21H,1-2,5,8,13H2,(H,22,23) |
| InChIKey | UREATBTVKFYDDI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|