C13H25N — CID 22154996
3,4,5,6-tetraethyl-2,3,4,5-tetrahydropyridine (PubChem CID 22154996) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 3,4,5,6-tetraethyl-2,3,4,5-tetrahydropyridine.
| Compound Name | 3,4,5,6-tetraethyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 22154996 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 3,4,5,6-tetraethyl-2,3,4,5-tetrahydropyridine |
| SMILES | CCC1=NCC(CC)C(CC)C1CC |
| InChI | InChI=1S/C13H25N/c1-5-10-9-14-13(8-4)12(7-3)11(10)6-2/h10-12H,5-9H2,1-4H3 |
| InChIKey | MKGQJCMYGGJDAY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |