C16H14ClF2N5O3 — CID 22156131
1-[4-[chloro(difluoro)methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-1-(2-methyl-6-nitrophenyl)urea (PubChem CID 22156131) has the molecular formula C16H14ClF2N5O3 and a molecular weight of 397.77 g/mol. Its IUPAC name is 1-[4-[chloro(difluoro)methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-1-(2-methyl-6-nitrophenyl)urea.
| Compound Name | 1-[4-[chloro(difluoro)methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-1-(2-methyl-6-nitrophenyl)urea |
|---|---|
| PubChem CID | 22156131 |
| Molecular Formula | C16H14ClF2N5O3 |
| Molecular Weight | 397.77 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-[4-[chloro(difluoro)methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-1-(2-methyl-6-nitrophenyl)urea |
| SMILES | Cc1cccc([N+](=O)[O-])c1N(C(N)=O)c1nc2c(c(C(F)(F)Cl)n1)CCC2 |
| InChI | InChI=1S/C16H14ClF2N5O3/c1-8-4-2-7-11(24(26)27)12(8)23(14(20)25)15-21-10-6-3-5-9(10)13(22-15)16(17,18)19/h2,4,7H,3,5-6H2,1H3,(H2,20,25) |
| InChIKey | BZKWKJOGYJRPEQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|