C5H9NO7P2-4 — CID 22156585
diphosphonato(pyrrolidin-2-yl)methanol (PubChem CID 22156585) has the molecular formula C5H9NO7P2-4 and a molecular weight of 257.07 g/mol. Its IUPAC name is diphosphonato(pyrrolidin-2-yl)methanol.
| Compound Name | diphosphonato(pyrrolidin-2-yl)methanol |
|---|---|
| PubChem CID | 22156585 |
| Molecular Formula | C5H9NO7P2-4 |
| Molecular Weight | 257.07 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | diphosphonato(pyrrolidin-2-yl)methanol |
| SMILES | O=P([O-])([O-])C(O)(C1CCCN1)P(=O)([O-])[O-] |
| InChI | InChI=1S/C5H13NO7P2/c7-5(14(8,9)10,15(11,12)13)4-2-1-3-6-4/h4,6-7H,1-3H2,(H2,8,9,10)(H2,11,12,13)/p-4 |
| InChIKey | CLYLMFMDQMXLHE-UHFFFAOYSA-J |
| XLogP | -3.79 |
| TPSA | 158.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.07 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|