C24H28N4O4S — CID 22157512
3-(3,4-dimethoxyphenyl)-5-[[4-(2-sulfanylidene-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22157512) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5-[[4-(2-sulfanylidene-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-5-[[4-(2-sulfanylidene-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22157512 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5-[[4-(2-sulfanylidene-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(N2CC(CN3CCC(n4c(=S)[nH]c5ccccc54)CC3)OC2=O)cc1OC |
| InChI | InChI=1S/C24H28N4O4S/c1-30-21-8-7-17(13-22(21)31-2)27-15-18(32-24(27)29)14-26-11-9-16(10-12-26)28-20-6-4-3-5-19(20)25-23(28)33/h3-8,13,16,18H,9-12,14-15H2,1-2H3,(H,25,33) |
| InChIKey | PMBKRILDXAUMMW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|