C45H58N2O4 — CID 22160241
1-[4-[[4-[2-hydroxy-3-(2,2,4,6-tetramethyl-3,4-dihydroquinolin-1-yl)propoxy]phenyl]methyl]phenoxy]-3-(2,2,4,6-tetramethyl-3,4-dihydroquinolin-1-yl)propan-2-ol (PubChem CID 22160241) has the molecular formula C45H58N2O4 and a molecular weight of 690.97 g/mol. Its IUPAC name is 1-[4-[[4-[2-hydroxy-3-(2,2,4,6-tetramethyl-3,4-dihydroquinolin-1-yl)propoxy]phenyl]methyl]phenoxy]-3-(2,2,4,6-tetramethyl-3,4-dihydroquinolin-1-yl)propan-2-ol.
| Compound Name | 1-[4-[[4-[2-hydroxy-3-(2,2,4,6-tetramethyl-3,4-dihydroquinolin-1-yl)propoxy]phenyl]methyl]phenoxy]-3-(2,2,4,6-tetramethyl-3,4-dihydroquinolin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 22160241 |
| Molecular Formula | C45H58N2O4 |
| Molecular Weight | 690.97 g/mol |
| Exact Mass | 690.44 |
| IUPAC Name | 1-[4-[[4-[2-hydroxy-3-(2,2,4,6-tetramethyl-3,4-dihydroquinolin-1-yl)propoxy]phenyl]methyl]phenoxy]-3-(2,2,4,6-tetramethyl-3,4-dihydroquinolin-1-yl)propan-2-ol |
| SMILES | Cc1ccc2c(c1)C(C)CC(C)(C)N2CC(O)COc1ccc(Cc2ccc(OCC(O)CN3c4ccc(C)cc4C(C)CC3(C)C)cc2)cc1 |
| InChI | InChI=1S/C45H58N2O4/c1-30-9-19-42-40(21-30)32(3)24-44(5,6)46(42)26-36(48)28-50-38-15-11-34(12-16-38)23-35-13-17-39(18-14-35)51-29-37(49)27-47-43-20-10-31(2)22-41(43)33(4)25-45(47,7)8/h9-22,32-33,36-37,48-49H,23-29H2,1-8H3 |
| InChIKey | MVVIXLCSJDFEAU-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.97 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |